Ampalex
Catalog No: FT-0657266
CAS No: 154235-83-3
- Chemical Name: Ampalex
- Molecular Formula: C14H15N3O
- Molecular Weight: 241.29
- InChI Key: ANDGGVOPIJEHOF-UHFFFAOYSA-N
- InChI: InChI=1S/C14H15N3O/c18-14(17-8-2-1-3-9-17)11-4-5-12-13(10-11)16-7-6-15-12/h4-7,10H,1-3,8-9H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 433.1±25.0 °C at 760 mmHg |
|---|---|
| CAS: | 154235-83-3 |
| MF: | C14H15N3O |
| Melting_Point: | 88-90ºC |
| Symbol: | Warning |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 241.288 |
| Product_Name: | Ampalex |
| Flash_Point: | 215.8±23.2 °C |
| Bolling_Point: | 433.1±25.0 °C at 760 mmHg |
|---|---|
| LogP: | 0.57 |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Density: | 1.2±0.1 g/cm3 |
| Melting_Point: | 88-90ºC |
| Exact_Mass: | 241.121506 |
| MF: | C14H15N3O |
| Refractive_Index: | 1.640 |
| PSA: | 46.09000 |
| Flash_Point: | 215.8±23.2 °C |
| FW: | 241.288 |
| Symbol: | Warning |
|---|---|
| HS_Code: | 2933990090 |
| Safety_Statements: | H302 |
| RTECS: | TM2785170 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)